Mixed-Metal Cluster Chemistry. 13. Syntheses, isomer distribution and fluxionality studies of Cp2W2Ir2(m-CO)3(CO)7-n(PR3)n (n = 1-2; R = Ph, Me); X-ray crystal structure of Cp2W2Ir2(m-CO)3(CO)6(PPh3)
| dc.contributor.author | Waterman, Susan | |
| dc.contributor.author | Lee, Jeanne | |
| dc.contributor.author | Ball, Graham | |
| dc.contributor.author | Hockless, David | |
| dc.contributor.author | Humphrey, Mark | |
| dc.date.accessioned | 2015-12-13T23:24:52Z | |
| dc.date.available | 2015-12-13T23:24:52Z | |
| dc.date.issued | 1999 | |
| dc.date.updated | 2015-12-12T09:22:17Z | |
| dc.identifier.issn | 0276-7333 | |
| dc.identifier.uri | http://hdl.handle.net/1885/92419 | |
| dc.publisher | American Chemical Society | |
| dc.source | Organometallics | |
| dc.title | Mixed-Metal Cluster Chemistry. 13. Syntheses, isomer distribution and fluxionality studies of Cp2W2Ir2(m-CO)3(CO)7-n(PR3)n (n = 1-2; R = Ph, Me); X-ray crystal structure of Cp2W2Ir2(m-CO)3(CO)6(PPh3) | |
| dc.type | Journal article | |
| local.bibliographicCitation.lastpage | 2451 | |
| local.bibliographicCitation.startpage | 2440 | |
| local.contributor.affiliation | Waterman, Susan, College of Physical and Mathematical Sciences, ANU | |
| local.contributor.affiliation | Humphrey, Mark, College of Physical and Mathematical Sciences, ANU | |
| local.contributor.affiliation | Lee, Jeanne, University of New England | |
| local.contributor.affiliation | Ball, Graham, University of New South Wales | |
| local.contributor.affiliation | Hockless, David, College of Physical and Mathematical Sciences, ANU | |
| local.contributor.authoruid | Waterman, Susan, u3847237 | |
| local.contributor.authoruid | Humphrey, Mark, u9400918 | |
| local.contributor.authoruid | Hockless, David, u930167 | |
| local.description.notes | Imported from ARIES | |
| local.description.refereed | Yes | |
| local.identifier.absfor | 039904 - Organometallic Chemistry | |
| local.identifier.ariespublication | MigratedxPub23519 | |
| local.identifier.citationvolume | 18 | |
| local.type.status | Published Version |