Transport of cis- and trans-4-[�8F]fluoro-L-proline in F98 glioma cells
| dc.contributor.author | Langen, Karl-Josef | |
| dc.contributor.author | Muhlensiepen, Heinz | |
| dc.contributor.author | Schmieder, Sven | |
| dc.contributor.author | Hamacher, Kurt | |
| dc.contributor.author | Broer, Stefan | |
| dc.contributor.author | Borner, Anne R | |
| dc.contributor.author | Schneeweiss, Frank | |
| dc.contributor.author | Coenen, Heinz | |
| dc.date.accessioned | 2015-12-13T23:39:57Z | |
| dc.date.issued | 2002 | |
| dc.date.updated | 2015-12-12T09:27:18Z | |
| dc.description.abstract | The transport mechanisms of cis-4-[18F]fluoro-L-proline (cis-FPro) and trans-4-[18F]fluoro-L-proline (trans-FPro) were studied in F98 rat glioma cells in comparison to the natural parent [3H]-L-proline. Uptake rates of cis-FPro and trans-FPro in F98 glioma cells were 50-70% lower than those of [3H]-L-proline. The amino transport system A inhibitor MeAIB reduced the uptake of [3H]-L-proline by 30% and uptake of cis-FPro by 46% while uptake of trans-FPro was not significantly changed. BCH inhibited the uptake of all tracers by 35-44%, serine by 70-90% and L-proline by 60-80%. Absence of Na+ reduced uptake of all tracers significantly but no further inhibitory effect could be observed which suggests a component of unspecific uptake. Radioactivity of cis- and trans-FPro in the acid precipitable fraction was <1% after 120 min incubation time while [3H]-L-proline exhibited a 20% incorporation into protein. Whole body PET scans in humans demonstrated a retention of cis-FPro in the renal cortex, liver and the pancreas while trans-FPro was retained particularly in muscles. We conclude that system A amino acid transport appears to be selectively relevant for cis-FPro which may contribute to the observed differences in whole body distribution of cis-FPro and trans-FPro in humans. | |
| dc.identifier.issn | 0969-8051 | |
| dc.identifier.uri | http://hdl.handle.net/1885/94252 | |
| dc.publisher | Elsevier | |
| dc.source | Nuclear Medicine and Biology | |
| dc.subject | Keywords: 4 aminobutyric acid; 4 fluoroproline f 18; diacetylsplenopentin; proline derivative; tracer; unclassified drug; acid precipitation; adult; amino acid transport; animal cell; article; controlled study; drug distribution; drug retention; drug transport; dru Amino acid transport; Cis- and trans-4-[18F]fluoro-L-proline; Glioma cells; PET; Whole body distribution | |
| dc.title | Transport of cis- and trans-4-[�8F]fluoro-L-proline in F98 glioma cells | |
| dc.type | Journal article | |
| local.bibliographicCitation.issue | 6 | |
| local.bibliographicCitation.lastpage | 692 | |
| local.bibliographicCitation.startpage | 685 | |
| local.contributor.affiliation | Langen, Karl-Josef, Research Center Julich | |
| local.contributor.affiliation | Muhlensiepen, Heinz, Research Center Julich | |
| local.contributor.affiliation | Schmieder, Sven, Research Center Julich | |
| local.contributor.affiliation | Hamacher, Kurt, Research Center Julich | |
| local.contributor.affiliation | Broer, Stefan, College of Medicine, Biology and Environment, ANU | |
| local.contributor.affiliation | Borner, Anne R, University of Hannover | |
| local.contributor.affiliation | Schneeweiss, Frank, Research Center Julich | |
| local.contributor.affiliation | Coenen, Heinz, Research Center Julich | |
| local.contributor.authoruid | Broer, Stefan, u4009041 | |
| local.description.embargo | 2037-12-31 | |
| local.description.notes | Imported from ARIES | |
| local.description.refereed | Yes | |
| local.identifier.absfor | 060110 - Receptors and Membrane Biology | |
| local.identifier.ariespublication | MigratedxPub23788 | |
| local.identifier.citationvolume | 29 | |
| local.identifier.doi | 10.1016/S0969-8051(02)00327-X | |
| local.identifier.scopusID | 2-s2.0-0036702212 | |
| local.type.status | Published Version |
Downloads
Original bundle
1 - 1 of 1
Loading...
- Name:
- 01_Langen_Transport_of_cis-_and_2002.pdf
- Size:
- 180.7 KB
- Format:
- Adobe Portable Document Format